CAS 284489-44-7 appears in our catalog under these names: 5-Chloro-2-hydroxybenzaldehyde 1,1-dimethylhydrazone, 95%, 4–Chloro–2–((dimethylhydrazono)methyl)phenol, 4-Chloro-2-((2,2-dimethylhydrazono)methyl)phenol, 95%. Offered by: Combi-blocks, GLPBio, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
4-chloro-2-[(E)-(dimethylhydrazinylidene)methyl]phenol (CAS 284489-44-7) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 4-chloro-2-[(E)-(dimethylhydrazinylidene)methyl]phenol. InChIKey: AQTCJZXPKUPBKW-IZZDOVSWSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 4-chloro-2-[(E)-(dimethylhydrazinylidene)methyl]phenol |
| InChIKey | AQTCJZXPKUPBKW-IZZDOVSWSA-N |
| SMILES | CN(C)/N=C/C1=C(C=CC(=C1)Cl)O |
Computed by PubChem (NCBI)