CAS 284493-64-7 appears in our catalog under these names: 3-N-Boc-3-(2,3-dichlorophenyl)propionic acid, 98%, Boc–3–Amino–3–(2,3–dichlorophenyl)–propionic acid, 3-N-Boc-3-(2,3-dichlorophenyl)propionic acid, 98%, 98%, BOc-3-Amino-3-(2,3-dichlorophenyl)-propionic acid, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
3-(2,3-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 284493-64-7) is a chemical compound with the molecular formula C14H17Cl2NO4 and a molecular weight of 334.2 g/mol. IUPAC name: 3-(2,3-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: KGXWCCCBQSYUKL-UHFFFAOYSA-N.
| Molecular formula | C14H17Cl2NO4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 3-(2,3-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | KGXWCCCBQSYUKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=C(C(=CC=C1)Cl)Cl |
Computed by PubChem (NCBI)