CAS 574729-44-5 is the registry number for 3-(Boc-amino)-2-(3,4-dichlorophenyl)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 50mg, 1g, 250mg.
2-(3,4-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 574729-44-5) is a chemical compound with the molecular formula C14H17Cl2NO4 and a molecular weight of 334.2 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: AHSMQJDTARPKCV-UHFFFAOYSA-N.
| Molecular formula | C14H17Cl2NO4 |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | AHSMQJDTARPKCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C1=CC(=C(C=C1)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)