CAS 284493-65-8 appears in our catalog under these names: 3-((tert-Butoxycarbonyl)amino)-3-(4-chlorophenyl)propanoic acid, 97%, 97%, 3- tert -Butoxycarbonylamino-3-(4-chloro-phenyl)-propionic acid, 97%, Boc-β-DL-Phe(4-Cl)-OH, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g.
3-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 284493-65-8) is a chemical compound with the molecular formula C14H18ClNO4 and a molecular weight of 299.75 g/mol. IUPAC name: 3-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZPXVKCUGZBGIBW-UHFFFAOYSA-N.
| Molecular formula | C14H18ClNO4 |
|---|---|
| Molecular weight | 299.75 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZPXVKCUGZBGIBW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)