CAS 2847800-41-1 is the registry number for Methyl (1R,4S)-bicyclo[2.2.1]hept-2-ene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (1R,4S)-bicyclo[2.2.1]hept-2-ene-2-carboxylate (CAS 2847800-41-1) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: methyl (1R,4S)-bicyclo[2.2.1]hept-2-ene-2-carboxylate. InChIKey: VYHVHWVKRQHORF-NKWVEPMBSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 152.19 g/mol |
| IUPAC name | methyl (1R,4S)-bicyclo[2.2.1]hept-2-ene-2-carboxylate |
| InChIKey | VYHVHWVKRQHORF-NKWVEPMBSA-N |
| SMILES | COC(=O)C1=C[C@H]2CC[C@@H]1C2 |
Computed by PubChem (NCBI)