CAS 28489-42-1 is the registry number for N,N,6-TRIMETHYL-5-NITROPYRIDIN-2-AMINE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N,N,6-trimethyl-5-nitropyridin-2-amine (CAS 28489-42-1) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: N,N,6-trimethyl-5-nitropyridin-2-amine. InChIKey: RKNNIONZGRIQJY-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | N,N,6-trimethyl-5-nitropyridin-2-amine |
| InChIKey | RKNNIONZGRIQJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=N1)N(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)