CAS 2849-81-2 is the registry number for N-(tert-Butyl)-4-methylbenzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 10g, 250mg, 1g, 5g.
N-tert-butyl-4-methylbenzenesulfonimidic acid (CAS 2849-81-2) is a chemical compound with the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. IUPAC name: N-tert-butyl-4-methylbenzenesulfonimidic acid. InChIKey: ZQRLETIQVVJIMC-UHFFFAOYSA-N.
| Molecular formula | C11H17NO2S |
|---|---|
| Molecular weight | 227.33 g/mol |
| IUPAC name | N-tert-butyl-4-methylbenzenesulfonimidic acid |
| InChIKey | ZQRLETIQVVJIMC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=NC(C)(C)C)(=O)O |
Computed by PubChem (NCBI)