CAS 2850326-69-9 is the registry number for ((3R,6S)-1,1-Difluoro-5-methyl-5-azaspiro[2.4]heptan-6-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R,6S)-2,2-difluoro-5-methyl-5-azaspiro[2.4]heptan-6-yl]methanol (CAS 2850326-69-9) is a chemical compound with the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. IUPAC name: [(3R,6S)-2,2-difluoro-5-methyl-5-azaspiro[2.4]heptan-6-yl]methanol. InChIKey: DDVRBQRXMOKCEI-NKWVEPMBSA-N.
| Molecular formula | C8H13F2NO |
|---|---|
| Molecular weight | 177.19 g/mol |
| IUPAC name | [(3R,6S)-2,2-difluoro-5-methyl-5-azaspiro[2.4]heptan-6-yl]methanol |
| InChIKey | DDVRBQRXMOKCEI-NKWVEPMBSA-N |
| SMILES | CN1C[C@@]2(C[C@H]1CO)CC2(F)F |
Computed by PubChem (NCBI)