CAS 2850344-69-1 is the registry number for ((2R)-2,6-Difluorotetrahydro-1H-pyrrolizin-7a(5H)-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(6R)-2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (CAS 2850344-69-1) is a chemical compound with the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. IUPAC name: [(6R)-2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol. InChIKey: LFJHHYZMNSMOBP-JECWYVHBSA-N.
| Molecular formula | C8H13F2NO |
|---|---|
| Molecular weight | 177.19 g/mol |
| IUPAC name | [(6R)-2,6-difluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| InChIKey | LFJHHYZMNSMOBP-JECWYVHBSA-N |
| SMILES | C1[C@H](CN2C1(CC(C2)F)CO)F |
Computed by PubChem (NCBI)