Products 28524-58-5
CAS 28524-58-5 is the registry number for 5-Amino-(1,2,4)triazolo(1,5-a)pyrimidine-6-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile (CAS 28524-58-5) is a chemical compound with the molecular formula C6H4N6 and a molecular weight of 160.14 g/mol. IUPAC name: 5-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile. InChIKey: LCDRZWPFFGXXGE-UHFFFAOYSA-N.
| Molecular formula | C6H4N6 |
|---|---|
| Molecular weight | 160.14 g/mol |
| IUPAC name | 5-amino-[1,2,4]triazolo[1,5-a]pyrimidine-6-carbonitrile |
| InChIKey | LCDRZWPFFGXXGE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC2=NC=NN21)N)C#N |
Computed by PubChem (NCBI)