CAS 58390-42-4 is the registry number for 4-Aminopyrazolo(5,1-c)(1,2,4)triazine-3-carbonitrile. Offered by: TRC. Available pack sizes: 750mg.
4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile (CAS 58390-42-4) is a chemical compound with the molecular formula C6H4N6 and a molecular weight of 160.14 g/mol. IUPAC name: 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile. InChIKey: IBDFEAAYRWQLBK-UHFFFAOYSA-N.
| Molecular formula | C6H4N6 |
|---|---|
| Molecular weight | 160.14 g/mol |
| IUPAC name | 4-aminopyrazolo[5,1-c][1,2,4]triazine-3-carbonitrile |
| InChIKey | IBDFEAAYRWQLBK-UHFFFAOYSA-N |
| SMILES | C1=C2N=NC(=C(N2N=C1)N)C#N |
Computed by PubChem (NCBI)