CAS 2857180-28-8 is the registry number for TrxR-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3-dimethoxy-5-methylphenanthridin-5-ium iodide (CAS 2857180-28-8) is a chemical compound with the molecular formula C16H16INO2 and a molecular weight of 381.21 g/mol. IUPAC name: 1,3-dimethoxy-5-methylphenanthridin-5-ium iodide. InChIKey: MATWSAIHYPADGV-UHFFFAOYSA-M.
| Molecular formula | C16H16INO2 |
|---|---|
| Molecular weight | 381.21 g/mol |
| IUPAC name | 1,3-dimethoxy-5-methylphenanthridin-5-ium iodide |
| InChIKey | MATWSAIHYPADGV-UHFFFAOYSA-M |
| SMILES | C[N+]1=CC2=CC=CC=C2C3=C1C=C(C=C3OC)OC.[I-] |
Computed by PubChem (NCBI)