CAS 418790-72-4 is the registry number for 4-Ethoxy-n-(4-iodo-2-methylphenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-ethoxy-N-(4-iodo-2-methylphenyl)benzamide (CAS 418790-72-4) is a chemical compound with the molecular formula C16H16INO2 and a molecular weight of 381.21 g/mol. IUPAC name: 4-ethoxy-N-(4-iodo-2-methylphenyl)benzamide. InChIKey: HHXWBFMHGFSOQK-UHFFFAOYSA-N.
| Molecular formula | C16H16INO2 |
|---|---|
| Molecular weight | 381.21 g/mol |
| IUPAC name | 4-ethoxy-N-(4-iodo-2-methylphenyl)benzamide |
| InChIKey | HHXWBFMHGFSOQK-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)I)C |
Computed by PubChem (NCBI)