CAS 2857901-53-0 is the registry number for (2S,5S)-2,3,4,5-Tetrahydro-2,5-methanobenzo[f][1,4]oxazepine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,9S)-8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (CAS 2857901-53-0) is a chemical compound with the molecular formula C10H11NO and a molecular weight of 161.20 g/mol. IUPAC name: (1S,9S)-8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene. InChIKey: UBOUWDUOOIWDPV-CBAPKCEASA-N.
| Molecular formula | C10H11NO |
|---|---|
| Molecular weight | 161.20 g/mol |
| IUPAC name | (1S,9S)-8-oxa-11-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| InChIKey | UBOUWDUOOIWDPV-CBAPKCEASA-N |
| SMILES | C1[C@H]2CN[C@@H]1C3=CC=CC=C3O2 |
Computed by PubChem (NCBI)