CAS 28594-60-7 appears in our catalog under these names: 2-(Pyridin-2-yl)quinazolin-4(1H)-one, 97%, 4-Hydroxy-2-(2-pyridyl)quinazoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,1g, 0,25g, 0,5g.
2-pyridin-2-yl-3H-quinazolin-4-one (CAS 28594-60-7) is a chemical compound with the molecular formula C13H9N3O and a molecular weight of 223.23 g/mol. IUPAC name: 2-pyridin-2-yl-3H-quinazolin-4-one. InChIKey: QLWDRAMFFJADEJ-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-pyridin-2-yl-3H-quinazolin-4-one |
| InChIKey | QLWDRAMFFJADEJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)