CAS 28597-08-2 appears in our catalog under these names: 3,4,5–Trichloro–2,6–dimethylpyridine, 3,4,5-Trichloro-2,6-dimethylpyridine 97%, 3,4,5-Trichloro-2,6-dimethylpyridine, 97%, 97%, 3,4,5-Trichloro-2,6-dimethylpyridine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
3,4,5-trichloro-2,6-dimethylpyridine (CAS 28597-08-2) is a chemical compound with the molecular formula C7H6Cl3N and a molecular weight of 210.5 g/mol. IUPAC name: 3,4,5-trichloro-2,6-dimethylpyridine. InChIKey: OHVYZELVCDIERE-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3N |
|---|---|
| Molecular weight | 210.5 g/mol |
| IUPAC name | 3,4,5-trichloro-2,6-dimethylpyridine |
| InChIKey | OHVYZELVCDIERE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)C)Cl)Cl)Cl |
Computed by PubChem (NCBI)