Products 929974-97-0
CAS 929974-97-0 is the registry number for 2,4-Dichloro-3-(chloromethyl)-6-methylpyridine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2,4-dichloro-3-(chloromethyl)-6-methylpyridine (CAS 929974-97-0) is a chemical compound with the molecular formula C7H6Cl3N and a molecular weight of 210.5 g/mol. IUPAC name: 2,4-dichloro-3-(chloromethyl)-6-methylpyridine. InChIKey: OHLZJPIKLHYHQB-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl3N |
|---|---|
| Molecular weight | 210.5 g/mol |
| IUPAC name | 2,4-dichloro-3-(chloromethyl)-6-methylpyridine |
| InChIKey | OHLZJPIKLHYHQB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=N1)Cl)CCl)Cl |
Computed by PubChem (NCBI)