CAS 285979-69-3 appears in our catalog under these names: Choline-1,1,2,2-d4 Bromide, 99 atom % D, min 98% Chemical Purity, Choline-1,1,2,2-d4 Bromide, >95% (HPLC), CHOLINE-1,1,2,2-D4 BROMIDE, 98 ATOM% D, Choline-1,1,2,2-d4 (bromide). Offered by: CDN, TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 0,5g, 100mg, 10mg, 50mg, 10 mg, 100 mg, 50 mg.
Trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium bromide (CAS 285979-69-3) is a chemical compound with the molecular formula C5H14BrNO and a molecular weight of 188.10 g/mol. IUPAC name: trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium bromide. InChIKey: JJCWKVUUIFLXNZ-HGFPCDIYSA-M.
| Molecular formula | C5H14BrNO |
|---|---|
| Molecular weight | 188.10 g/mol |
| IUPAC name | trimethyl-(1,1,2,2-tetradeuterio-2-hydroxyethyl)azanium bromide |
| InChIKey | JJCWKVUUIFLXNZ-HGFPCDIYSA-M |
| SMILES | [2H]C([2H])(C([2H])([2H])O)[N+](C)(C)C.[Br-] |
Computed by PubChem (NCBI)