Products 287100-59-8

CAS 287100-59-8 is the registry number for CHOLINE BROMIDE-METHYL-13C1, 99 ATOM % 1. Offered by: Sigma-Aldrich. Available pack sizes: 500MG.

Structural formula: {0} (CAS {1})

2-hydroxyethyl-dimethyl-(113C)methylazanium bromide (CAS 287100-59-8) is a chemical compound with the molecular formula C5H14BrNO and a molecular weight of 185.07 g/mol. IUPAC name: 2-hydroxyethyl-dimethyl-(113C)methylazanium bromide. InChIKey: JJCWKVUUIFLXNZ-YTBWXGASSA-M.

Identity
Molecular formulaC5H14BrNO
Molecular weight185.07 g/mol
IUPAC name2-hydroxyethyl-dimethyl-(113C)methylazanium bromide
InChIKeyJJCWKVUUIFLXNZ-YTBWXGASSA-M
SMILESC[N+](C)([13CH3])CCO.[Br-]

Computed by PubChem (NCBI)