CAS 287100-59-8 is the registry number for CHOLINE BROMIDE-METHYL-13C1, 99 ATOM % 1. Offered by: Sigma-Aldrich. Available pack sizes: 500MG.
2-hydroxyethyl-dimethyl-(113C)methylazanium bromide (CAS 287100-59-8) is a chemical compound with the molecular formula C5H14BrNO and a molecular weight of 185.07 g/mol. IUPAC name: 2-hydroxyethyl-dimethyl-(113C)methylazanium bromide. InChIKey: JJCWKVUUIFLXNZ-YTBWXGASSA-M.
| Molecular formula | C5H14BrNO |
|---|---|
| Molecular weight | 185.07 g/mol |
| IUPAC name | 2-hydroxyethyl-dimethyl-(113C)methylazanium bromide |
| InChIKey | JJCWKVUUIFLXNZ-YTBWXGASSA-M |
| SMILES | C[N+](C)([13CH3])CCO.[Br-] |
Computed by PubChem (NCBI)