CAS 285979-85-3 appears in our catalog under these names: N-(Carboxymethyl)-N,N,N-trimethyl-d9-ammonium Chloride, 99 atom % D, min 98% Chemical Purity, N–(CARBOXYMETHYL)–N,N,N–TRIMETHYL–D9–AMMONIUM CHLORIDE, N,N,N-TRIMETHYL-D9-GLYCINE HCL (BETAINE, Betaine-d9 (chloride), 99.66%. Offered by: CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 5mg, 1G, 25 mg, 10 mg, 50 mg.
2-[tris(trideuteriomethyl)azaniumyl]acetate;hydrochloride (CAS 285979-85-3) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 162.66 g/mol. IUPAC name: 2-[tris(trideuteriomethyl)azaniumyl]acetate;hydrochloride. InChIKey: HOPSCVCBEOCPJZ-KYRNGWDOSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 162.66 g/mol |
| IUPAC name | 2-[tris(trideuteriomethyl)azaniumyl]acetate;hydrochloride |
| InChIKey | HOPSCVCBEOCPJZ-KYRNGWDOSA-N |
| SMILES | [2H]C([2H])([2H])[N+](CC(=O)[O-])(C([2H])([2H])[2H])C([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)