CAS 286012-94-0 is the registry number for PHENYL-13C6 ISOCYANATE, 99 ATOM% 13C. Offered by: Sigma-Aldrich. Available pack sizes: 100MG.
Isocyanato(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 286012-94-0) is a chemical compound with the molecular formula C7H5NO and a molecular weight of 125.077 g/mol. IUPAC name: isocyanato(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: DGTNSSLYPYDJGL-ZXJNGCBISA-N.
| Molecular formula | C7H5NO |
|---|---|
| Molecular weight | 125.077 g/mol |
| IUPAC name | isocyanato(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | DGTNSSLYPYDJGL-ZXJNGCBISA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)N=C=O |
Computed by PubChem (NCBI)