CAS 83286-56-0 is the registry number for PHENYL-D5 ISOCYANATE, 98 ATOM % D. Offered by: Sigma-Aldrich. Available pack sizes: 1G.
1,2,3,4,5-pentadeuterio-6-isocyanatobenzene (CAS 83286-56-0) is a chemical compound with the molecular formula C7H5NO and a molecular weight of 124.15 g/mol. IUPAC name: 1,2,3,4,5-pentadeuterio-6-isocyanatobenzene. InChIKey: DGTNSSLYPYDJGL-RALIUCGRSA-N.
| Molecular formula | C7H5NO |
|---|---|
| Molecular weight | 124.15 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuterio-6-isocyanatobenzene |
| InChIKey | DGTNSSLYPYDJGL-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])N=C=O)[2H])[2H] |
Computed by PubChem (NCBI)