Products 286013-13-6
CAS 286013-13-6 is the registry number for 1,4-Bis(trifluoromethyl)benzene-13C6. Offered by: TRC. Available pack sizes: 10mg.
1,4-bis(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 286013-13-6) is a chemical compound with the molecular formula C8H4F6 and a molecular weight of 220.06 g/mol. IUPAC name: 1,4-bis(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: PDCBZHHORLHNCZ-IDEBNGHGSA-N.
| Molecular formula | C8H4F6 |
|---|---|
| Molecular weight | 220.06 g/mol |
| IUPAC name | 1,4-bis(trifluoromethyl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | PDCBZHHORLHNCZ-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)