Products 2863687-18-5
CAS 2863687-18-5 appears in our catalog under these names: 5-(3-bromo-4,5-dihydroisoxazol-5-yl)-3-(4-(tert-butyl)phenyl)-1,2,4-oxadiazole, Antileishmanial agent-2. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
5-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)-3-(4-tert-butylphenyl)-1,2,4-oxadiazole (CAS 2863687-18-5) is a chemical compound with the molecular formula C15H16BrN3O2 and a molecular weight of 350.21 g/mol. IUPAC name: 5-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)-3-(4-tert-butylphenyl)-1,2,4-oxadiazole. InChIKey: GXEBTEDSQDGJJR-UHFFFAOYSA-N.
| Molecular formula | C15H16BrN3O2 |
|---|---|
| Molecular weight | 350.21 g/mol |
| IUPAC name | 5-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)-3-(4-tert-butylphenyl)-1,2,4-oxadiazole |
| InChIKey | GXEBTEDSQDGJJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NOC(=N2)C3CC(=NO3)Br |
Computed by PubChem (NCBI)