Products 3033386-12-5
CAS 3033386-12-5 is the registry number for Antimalarial agent 3. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)-5-(4-tert-butylphenyl)-1,3,4-oxadiazole (CAS 3033386-12-5) is a chemical compound with the molecular formula C15H16BrN3O2 and a molecular weight of 350.21 g/mol. IUPAC name: 2-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)-5-(4-tert-butylphenyl)-1,3,4-oxadiazole. InChIKey: AEOBOORNXVKNNX-UHFFFAOYSA-N.
| Molecular formula | C15H16BrN3O2 |
|---|---|
| Molecular weight | 350.21 g/mol |
| IUPAC name | 2-(3-bromo-4,5-dihydro-1,2-oxazol-5-yl)-5-(4-tert-butylphenyl)-1,3,4-oxadiazole |
| InChIKey | AEOBOORNXVKNNX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NN=C(O2)C3CC(=NO3)Br |
Computed by PubChem (NCBI)
Synonyms:
Antimalarial agent 3, orb3177849