CAS 286371-63-9 is the registry number for 2-Chloro-4-((6,7-dimethoxyquinazolin-4-yl)oxy)aniline, 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-chloro-4-(6,7-dimethoxyquinazolin-4-yl)oxyaniline (CAS 286371-63-9) is a chemical compound with the molecular formula C16H14ClN3O3 and a molecular weight of 331.75 g/mol. IUPAC name: 2-chloro-4-(6,7-dimethoxyquinazolin-4-yl)oxyaniline. InChIKey: JWNJXRODWCORFX-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O3 |
|---|---|
| Molecular weight | 331.75 g/mol |
| IUPAC name | 2-chloro-4-(6,7-dimethoxyquinazolin-4-yl)oxyaniline |
| InChIKey | JWNJXRODWCORFX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)OC3=CC(=C(C=C3)N)Cl)OC |
Computed by PubChem (NCBI)