CAS 687627-78-7 is the registry number for NOD1-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-5-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol (CAS 687627-78-7) is a chemical compound with the molecular formula C16H14ClN3O3 and a molecular weight of 331.75 g/mol. IUPAC name: 2-chloro-5-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol. InChIKey: CEQUQTKEVIQAMX-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3O3 |
|---|---|
| Molecular weight | 331.75 g/mol |
| IUPAC name | 2-chloro-5-[(6,7-dimethoxyquinazolin-4-yl)amino]phenol |
| InChIKey | CEQUQTKEVIQAMX-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC(=C(C=C3)Cl)O)OC |
Computed by PubChem (NCBI)