Products 28638-47-3
CAS 28638-47-3 is the registry number for 2,2-Dimethyl Metolazone, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg.
7-chloro-2,2-dimethyl-4-oxo-3-phenyl-1H-quinazoline-6-sulfonamide (CAS 28638-47-3) is a chemical compound with the molecular formula C16H16ClN3O3S and a molecular weight of 365.8 g/mol. IUPAC name: 7-chloro-2,2-dimethyl-4-oxo-3-phenyl-1H-quinazoline-6-sulfonamide. InChIKey: SXFLRAGFJYCTEJ-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3O3S |
|---|---|
| Molecular weight | 365.8 g/mol |
| IUPAC name | 7-chloro-2,2-dimethyl-4-oxo-3-phenyl-1H-quinazoline-6-sulfonamide |
| InChIKey | SXFLRAGFJYCTEJ-UHFFFAOYSA-N |
| SMILES | CC1(NC2=CC(=C(C=C2C(=O)N1C3=CC=CC=C3)S(=O)(=O)N)Cl)C |
Computed by PubChem (NCBI)
Synonyms:
2,2-Dimethyl Metolazone