Products 75820-08-5
CAS 75820-08-5 is the registry number for Zidapamide. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
4-chloro-N-(1-methyl-1,3-dihydroisoindol-2-yl)-3-sulfamoylbenzamide (CAS 75820-08-5) is a chemical compound with the molecular formula C16H16ClN3O3S and a molecular weight of 365.8 g/mol. IUPAC name: 4-chloro-N-(1-methyl-1,3-dihydroisoindol-2-yl)-3-sulfamoylbenzamide. InChIKey: BHUKYXOYJMLRAK-UHFFFAOYSA-N.
| Molecular formula | C16H16ClN3O3S |
|---|---|
| Molecular weight | 365.8 g/mol |
| IUPAC name | 4-chloro-N-(1-methyl-1,3-dihydroisoindol-2-yl)-3-sulfamoylbenzamide |
| InChIKey | BHUKYXOYJMLRAK-UHFFFAOYSA-N |
| SMILES | CC1C2=CC=CC=C2CN1NC(=O)C3=CC(=C(C=C3)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)