CAS 286426-31-1 appears in our catalog under these names: Phenylephrine EP Impurity D ((S)-Isomer), Epinephrine Impurity 7, Phenylephrine Impurity 6（Phenylephrine EP Impurity D (S)-Isomer). Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
3-[(1S)-2-[benzyl(methyl)amino]-1-hydroxyethyl]phenol (CAS 286426-31-1) is a chemical compound with the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. IUPAC name: 3-[(1S)-2-[benzyl(methyl)amino]-1-hydroxyethyl]phenol. InChIKey: JBBZPOHBHNEKIM-MRXNPFEDSA-N.
| Molecular formula | C16H19NO2 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 3-[(1S)-2-[benzyl(methyl)amino]-1-hydroxyethyl]phenol |
| InChIKey | JBBZPOHBHNEKIM-MRXNPFEDSA-N |
| SMILES | CN(CC1=CC=CC=C1)C[C@H](C2=CC(=CC=C2)O)O |
Computed by PubChem (NCBI)