Products 286460-72-8
CAS 286460-72-8 appears in our catalog under these names: D-Alanine-13C3, D-Alanine-13C3 13C 99atom %. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: Get quote, 100MG.
(2R)-2-amino(1,2,3-13C3)propanoic acid (CAS 286460-72-8) is a chemical compound with the molecular formula C3H7NO2 and a molecular weight of 92.072 g/mol. IUPAC name: (2R)-2-amino(1,2,3-13C3)propanoic acid. InChIKey: QNAYBMKLOCPYGJ-FMYLKJIZSA-N.
| Molecular formula | C3H7NO2 |
|---|---|
| Molecular weight | 92.072 g/mol |
| IUPAC name | (2R)-2-amino(1,2,3-13C3)propanoic acid |
| InChIKey | QNAYBMKLOCPYGJ-FMYLKJIZSA-N |
| SMILES | [13CH3][13C@H]([13C](=O)O)N |
Computed by PubChem (NCBI)