Products 28657-88-7
CAS 28657-88-7 appears in our catalog under these names: Ferroptosis Inducer 24, Ferroptosis inducer-2, 98.0%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM/1mL, 50 mg, 100 mg, 10 mg.
2-(1H-indol-3-yl)ethyl (E)-3-phenylprop-2-enoate (CAS 28657-88-7) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 2-(1H-indol-3-yl)ethyl (E)-3-phenylprop-2-enoate. InChIKey: UKBRRPUKMUGTQR-ZHACJKMWSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 2-(1H-indol-3-yl)ethyl (E)-3-phenylprop-2-enoate |
| InChIKey | UKBRRPUKMUGTQR-ZHACJKMWSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)OCCC2=CNC3=CC=CC=C32 |
Computed by PubChem (NCBI)
Synonyms:
Ferroptosis inducer-2, Ferroptosis Inducer 24