Products 2866315-46-8
CAS 2866315-46-8 is the registry number for tert-Butyl 5-methyl-6-oxo-2,5-diazaspiro[3.4]octane-2-carboxylate, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 5-methyl-6-oxo-2,5-diazaspiro[3.4]octane-2-carboxylate (CAS 2866315-46-8) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 5-methyl-6-oxo-2,5-diazaspiro[3.4]octane-2-carboxylate. InChIKey: XGLVYSDSUFMBKK-UHFFFAOYSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl 5-methyl-6-oxo-2,5-diazaspiro[3.4]octane-2-carboxylate |
| InChIKey | XGLVYSDSUFMBKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CCC(=O)N2C |
Computed by PubChem (NCBI)