CAS 2867630-96-2 is the registry number for SIRT6 activator 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(2-methoxyanilino)-4-[[4-(4-nitrophenoxy)cyclohexyl]amino]cyclobut-3-ene-1,2-dione (CAS 2867630-96-2) is a chemical compound with the molecular formula C23H23N3O6 and a molecular weight of 437.4 g/mol. IUPAC name: 3-(2-methoxyanilino)-4-[[4-(4-nitrophenoxy)cyclohexyl]amino]cyclobut-3-ene-1,2-dione. InChIKey: QOUGVEYUNOFEBQ-UHFFFAOYSA-N.
| Molecular formula | C23H23N3O6 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | 3-(2-methoxyanilino)-4-[[4-(4-nitrophenoxy)cyclohexyl]amino]cyclobut-3-ene-1,2-dione |
| InChIKey | QOUGVEYUNOFEBQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NC2=C(C(=O)C2=O)NC3CCC(CC3)OC4=CC=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)