Products 576170-87-1
CAS 576170-87-1 is the registry number for N'–(4–Hydroxy–3–nitrobenzoyl)–3–(4–pentylphenyl)–2–furohydrazide. Offered by: GLPBio. Available pack sizes: 5mg.
N'-(4-hydroxy-3-nitrobenzoyl)-3-(4-pentylphenyl)furan-2-carbohydrazide (CAS 576170-87-1) is a chemical compound with the molecular formula C23H23N3O6 and a molecular weight of 437.4 g/mol. IUPAC name: N'-(4-hydroxy-3-nitrobenzoyl)-3-(4-pentylphenyl)furan-2-carbohydrazide. InChIKey: XOVVMEVNXYGYEG-UHFFFAOYSA-N.
| Molecular formula | C23H23N3O6 |
|---|---|
| Molecular weight | 437.4 g/mol |
| IUPAC name | N'-(4-hydroxy-3-nitrobenzoyl)-3-(4-pentylphenyl)furan-2-carbohydrazide |
| InChIKey | XOVVMEVNXYGYEG-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C2=C(OC=C2)C(=O)NNC(=O)C3=CC(=C(C=C3)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)