CAS 286834-85-3 is the registry number for 1-(1-Benzofuran-6-yl)propan-2-amine. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg.
1-(1-benzofuran-6-yl)propan-2-amine (CAS 286834-85-3) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1-(1-benzofuran-6-yl)propan-2-amine. InChIKey: FQDAMYLMQQKPRX-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1-(1-benzofuran-6-yl)propan-2-amine |
| InChIKey | FQDAMYLMQQKPRX-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)C=CO2)N |
Computed by PubChem (NCBI)