CAS 286947-86-2 appears in our catalog under these names: 3-(2-Chlorophenyl)-3-phenylpropanoic acid, 95%, 3-(2-Chlorophenyl)-3-phenylpropanoic acid, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 250mg, 1g, 25g, 50g, 100g, 200g, 300g, 400g.
3-(2-chlorophenyl)-3-phenylpropanoic acid (CAS 286947-86-2) is a chemical compound with the molecular formula C15H13ClO2 and a molecular weight of 260.71 g/mol. IUPAC name: 3-(2-chlorophenyl)-3-phenylpropanoic acid. InChIKey: UXRBWQKJQGCCJE-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO2 |
|---|---|
| Molecular weight | 260.71 g/mol |
| IUPAC name | 3-(2-chlorophenyl)-3-phenylpropanoic acid |
| InChIKey | UXRBWQKJQGCCJE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(=O)O)C2=CC=CC=C2Cl |
Computed by PubChem (NCBI)