CAS 287111-36-8 appears in our catalog under these names: 4-Hydroxy-4-methyltetrahydro-2H-pyran-2-one-2,3-13C2, 98%, MEVALONOLACTONE-1,2-13C2, 99 ATOM % 13C&. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 500MG.
4-hydroxy-4-methyl(2,3-13C2)oxan-2-one (CAS 287111-36-8) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 132.13 g/mol. IUPAC name: 4-hydroxy-4-methyl(2,3-13C2)oxan-2-one. InChIKey: JYVXNLLUYHCIIH-MQIHXRCWSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 132.13 g/mol |
| IUPAC name | 4-hydroxy-4-methyl(2,3-13C2)oxan-2-one |
| InChIKey | JYVXNLLUYHCIIH-MQIHXRCWSA-N |
| SMILES | CC1(CCO[13C](=O)[13CH2]1)O |
Computed by PubChem (NCBI)