CAS 61219-76-9 appears in our catalog under these names: D,L-Mevalonic Acid Lactone-d3, (±)-Mevalonolactone-d3 (methyl-d3), 99 atom % D, min 97% Chemical Purity, DL-Mevalonolactone-d3. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 10mg, 1mg, 0,025g, 1 mg, 10 mg, 5 mg.
4-hydroxy-4-(trideuteriomethyl)oxan-2-one (CAS 61219-76-9) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 133.16 g/mol. IUPAC name: 4-hydroxy-4-(trideuteriomethyl)oxan-2-one. InChIKey: JYVXNLLUYHCIIH-FIBGUPNXSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 133.16 g/mol |
| IUPAC name | 4-hydroxy-4-(trideuteriomethyl)oxan-2-one |
| InChIKey | JYVXNLLUYHCIIH-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C1(CCOC(=O)C1)O |
Computed by PubChem (NCBI)