CAS 287399-34-2 is the registry number for Naphthalene-13C6. Offered by: TRC. Available pack sizes: 100mg.
Naphthalene (CAS 287399-34-2) is a chemical compound with the molecular formula C10H8 and a molecular weight of 134.13 g/mol. IUPAC name: naphthalene. InChIKey: UFWIBTONFRDIAS-TUSAXXEXSA-N.
| Molecular formula | C10H8 |
|---|---|
| Molecular weight | 134.13 g/mol |
| IUPAC name | naphthalene |
| InChIKey | UFWIBTONFRDIAS-TUSAXXEXSA-N |
| SMILES | C1=C[13C]2=[13CH][13CH]=[13CH][13CH]=[13C]2C=C1 |
Computed by PubChem (NCBI)