Products 875-62-7

CAS 875-62-7 is the registry number for Naphthalene-1-d1, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

1-deuterionaphthalene (CAS 875-62-7) is a chemical compound with the molecular formula C10H8 and a molecular weight of 129.18 g/mol. IUPAC name: 1-deuterionaphthalene. InChIKey: UFWIBTONFRDIAS-UICOGKGYSA-N.

Identity
Molecular formulaC10H8
Molecular weight129.18 g/mol
IUPAC name1-deuterionaphthalene
InChIKeyUFWIBTONFRDIAS-UICOGKGYSA-N
SMILES[2H]C1=C2C=CC=CC2=CC=C1

Computed by PubChem (NCBI)