CAS 2875-10-7 appears in our catalog under these names: 2,3,5,6-Tetrafluoroisonicotinic acid, 95%, 2,3,5,6-Tetrafluoroisonicotinic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
2,3,5,6-tetrafluoropyridine-4-carboxylic acid (CAS 2875-10-7) is a chemical compound with the molecular formula C6HF4NO2 and a molecular weight of 195.07 g/mol. IUPAC name: 2,3,5,6-tetrafluoropyridine-4-carboxylic acid. InChIKey: AMMDBAYDZHUEHR-UHFFFAOYSA-N.
| Molecular formula | C6HF4NO2 |
|---|---|
| Molecular weight | 195.07 g/mol |
| IUPAC name | 2,3,5,6-tetrafluoropyridine-4-carboxylic acid |
| InChIKey | AMMDBAYDZHUEHR-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=NC(=C1F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)