CAS 6257-03-0 appears in our catalog under these names: 1,2,4,5–Tetrafluoro–3–nitrobenzene, 1,2,4,5-Tetrafluoro-3-nitrobenzene 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 10g, 1g, 25g, 5g, 250mg.
1,2,4,5-tetrafluoro-3-nitrobenzene (CAS 6257-03-0) is a chemical compound with the molecular formula C6HF4NO2 and a molecular weight of 195.07 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-nitrobenzene. InChIKey: YLNJZWIHZRLYRI-UHFFFAOYSA-N.
| Molecular formula | C6HF4NO2 |
|---|---|
| Molecular weight | 195.07 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-nitrobenzene |
| InChIKey | YLNJZWIHZRLYRI-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)