CAS 2875037-12-8 is the registry number for rel-(2R,5R)-5-Fluoro-2-methylazepane hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,5R)-5-fluoro-2-methylazepane;hydrochloride (CAS 2875037-12-8) is a chemical compound with the molecular formula C7H15ClFN and a molecular weight of 167.65 g/mol. IUPAC name: (2R,5R)-5-fluoro-2-methylazepane;hydrochloride. InChIKey: MDZCPJCDTJLWIT-ZJLYAJKPSA-N.
| Molecular formula | C7H15ClFN |
|---|---|
| Molecular weight | 167.65 g/mol |
| IUPAC name | (2R,5R)-5-fluoro-2-methylazepane;hydrochloride |
| InChIKey | MDZCPJCDTJLWIT-ZJLYAJKPSA-N |
| SMILES | C[C@@H]1CC[C@H](CCN1)F.Cl |
Computed by PubChem (NCBI)