CAS 2903452-61-7 is the registry number for rel-(3S,4S,5R)-4-fluoro-3,5-dimethylpiperidine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,5R)-4-fluoro-3,5-dimethylpiperidine;hydrochloride (CAS 2903452-61-7) is a chemical compound with the molecular formula C7H15ClFN and a molecular weight of 167.65 g/mol. IUPAC name: (3S,5R)-4-fluoro-3,5-dimethylpiperidine;hydrochloride. InChIKey: BIXQZMZQGIZJHF-VPEOJXMDSA-N.
| Molecular formula | C7H15ClFN |
|---|---|
| Molecular weight | 167.65 g/mol |
| IUPAC name | (3S,5R)-4-fluoro-3,5-dimethylpiperidine;hydrochloride |
| InChIKey | BIXQZMZQGIZJHF-VPEOJXMDSA-N |
| SMILES | C[C@@H]1CNC[C@@H](C1F)C.Cl |
Computed by PubChem (NCBI)