Products 2875066-98-9
CAS 2875066-98-9 is the registry number for (3S,4S,5R)-4,5-Dimethyl-2-oxo-5-(trifluoromethyl)tetrahydrofuran-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4S,5R)-4,5-dimethyl-2-oxo-5-(trifluoromethyl)oxolane-3-carboxylic acid (CAS 2875066-98-9) is a chemical compound with the molecular formula C8H9F3O4 and a molecular weight of 226.15 g/mol. IUPAC name: (3S,4S,5R)-4,5-dimethyl-2-oxo-5-(trifluoromethyl)oxolane-3-carboxylic acid. InChIKey: OWOJOYFUAABHQH-VJJSXZLQSA-N.
| Molecular formula | C8H9F3O4 |
|---|---|
| Molecular weight | 226.15 g/mol |
| IUPAC name | (3S,4S,5R)-4,5-dimethyl-2-oxo-5-(trifluoromethyl)oxolane-3-carboxylic acid |
| InChIKey | OWOJOYFUAABHQH-VJJSXZLQSA-N |
| SMILES | C[C@H]1[C@H](C(=O)O[C@@]1(C)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)