Products 2250242-02-3

CAS 2250242-02-3 is the registry number for 2-Ethoxycarbonyl-2-(trifluoromethyl)cyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-ethoxycarbonyl-2-(trifluoromethyl)cyclopropane-1-carboxylic acid (CAS 2250242-02-3) is a chemical compound with the molecular formula C8H9F3O4 and a molecular weight of 226.15 g/mol. IUPAC name: 2-ethoxycarbonyl-2-(trifluoromethyl)cyclopropane-1-carboxylic acid. InChIKey: FLYNGOWDBUODRZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9F3O4
Molecular weight226.15 g/mol
IUPAC name2-ethoxycarbonyl-2-(trifluoromethyl)cyclopropane-1-carboxylic acid
InChIKeyFLYNGOWDBUODRZ-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CC1C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)