Products 1137830-21-7

CAS 1137830-21-7 is the registry number for 2-Oxo-2-(2,2,2-trifluoroethoxy)ethyl methacrylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-methylprop-2-enoate (CAS 1137830-21-7) is a chemical compound with the molecular formula C8H9F3O4 and a molecular weight of 226.15 g/mol. IUPAC name: [2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-methylprop-2-enoate. InChIKey: FCTRDJWCVGCPPR-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9F3O4
Molecular weight226.15 g/mol
IUPAC name[2-oxo-2-(2,2,2-trifluoroethoxy)ethyl] 2-methylprop-2-enoate
InChIKeyFCTRDJWCVGCPPR-UHFFFAOYSA-N
SMILESCC(=C)C(=O)OCC(=O)OCC(F)(F)F

Computed by PubChem (NCBI)