CAS 2876-23-5 is the registry number for Phenazin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Phenazin-2-amine (CAS 2876-23-5) is a chemical compound with the molecular formula C12H9N3 and a molecular weight of 195.22 g/mol. IUPAC name: phenazin-2-amine. InChIKey: RHQTYDDJBYBCQV-UHFFFAOYSA-N.
| Molecular formula | C12H9N3 |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | phenazin-2-amine |
| InChIKey | RHQTYDDJBYBCQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3C=CC(=CC3=N2)N |
Computed by PubChem (NCBI)