CAS 2878423-91-5 is the registry number for Ethyl (4S,5R)-4-hydroxy-5-methyl-5-(trifluoromethyl)-4,5-dihydrofuran-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R,3S)-3-hydroxy-2-methyl-2-(trifluoromethyl)-3H-furan-5-carboxylate (CAS 2878423-91-5) is a chemical compound with the molecular formula C9H11F3O4 and a molecular weight of 240.18 g/mol. IUPAC name: ethyl (2R,3S)-3-hydroxy-2-methyl-2-(trifluoromethyl)-3H-furan-5-carboxylate. InChIKey: HCBLTPXQPUJDAE-POYBYMJQSA-N.
| Molecular formula | C9H11F3O4 |
|---|---|
| Molecular weight | 240.18 g/mol |
| IUPAC name | ethyl (2R,3S)-3-hydroxy-2-methyl-2-(trifluoromethyl)-3H-furan-5-carboxylate |
| InChIKey | HCBLTPXQPUJDAE-POYBYMJQSA-N |
| SMILES | CCOC(=O)C1=C[C@@H]([C@](O1)(C)C(F)(F)F)O |
Computed by PubChem (NCBI)